CAS 565195-46-2 appears in our catalog under these names: 3-[(3,4-Dimethyl-benzenesulfonyl)-(4-methoxy-phenyl)-amino]-propionic acid, 95%, 3-(N-(4-Methoxyphenyl)3,4-dimethylbenzenesulfonamido)propanoic acid, 95%, 3-(N-(4-Methoxyphenyl)3,4-dimethylbenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(N-(3,4-dimethylphenyl)sulfonyl-4-methoxyanilino)propanoic acid (CAS 565195-46-2) is a chemical compound with the molecular formula C18H21NO5S and a molecular weight of 363.4 g/mol. IUPAC name: 3-(N-(3,4-dimethylphenyl)sulfonyl-4-methoxyanilino)propanoic acid. InChIKey: ISKJTAWWVLKNLX-UHFFFAOYSA-N.
| Molecular formula | C18H21NO5S |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3-(N-(3,4-dimethylphenyl)sulfonyl-4-methoxyanilino)propanoic acid |
| InChIKey | ISKJTAWWVLKNLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N(CCC(=O)O)C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)