Products 68076-37-9

CAS 68076-37-9 is the registry number for 3-(((Benzyloxy)carbonyl)amino)propyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(phenylmethoxycarbonylamino)propyl 4-methylbenzenesulfonate (CAS 68076-37-9) is a chemical compound with the molecular formula C18H21NO5S and a molecular weight of 363.4 g/mol. IUPAC name: 3-(phenylmethoxycarbonylamino)propyl 4-methylbenzenesulfonate. InChIKey: WJJVQUFWIDODJM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21NO5S
Molecular weight363.4 g/mol
IUPAC name3-(phenylmethoxycarbonylamino)propyl 4-methylbenzenesulfonate
InChIKeyWJJVQUFWIDODJM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCCNC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)