CAS 16578-60-2 appears in our catalog under these names: 2-Nitro-1,3-benzenedimethanol, 2-Nitro-1,3-benzenedimethanol, >95%, >95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 500mg, 100mg, 250mg.
[3-(hydroxymethyl)-2-nitrophenyl]methanol (CAS 16578-60-2) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: [3-(hydroxymethyl)-2-nitrophenyl]methanol. InChIKey: KZYWBYBQPIOWIY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | [3-(hydroxymethyl)-2-nitrophenyl]methanol |
| InChIKey | KZYWBYBQPIOWIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)CO)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)