CAS 1658-77-1 is the registry number for 3-Benzyl-7,8-dihydroxy-4-methyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-benzyl-7,8-dihydroxy-4-methylchromen-2-one (CAS 1658-77-1) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 3-benzyl-7,8-dihydroxy-4-methylchromen-2-one. InChIKey: DLDOVDSFVAFCQE-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 3-benzyl-7,8-dihydroxy-4-methylchromen-2-one |
| InChIKey | DLDOVDSFVAFCQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)