CAS 165947-83-1 is the registry number for Noradrenaline (Norepinephrine) Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
2-azido-1-(3,4-dihydroxyphenyl)ethanone (CAS 165947-83-1) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 2-azido-1-(3,4-dihydroxyphenyl)ethanone. InChIKey: SMTHBLYIAYTTHN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-azido-1-(3,4-dihydroxyphenyl)ethanone |
| InChIKey | SMTHBLYIAYTTHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CN=[N+]=[N-])O)O |
Computed by PubChem (NCBI)