CAS 165949-84-8 appears in our catalog under these names: 3-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%, 3–(1–((tert–Butoxycarbonyl)amino)ethyl)benzoic acid, 3-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 90%, 90%, 3-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 90%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 165949-84-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: JWYITCUSPYOBSX-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
| InChIKey | JWYITCUSPYOBSX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)