CAS 193150-14-0 appears in our catalog under these names: (R)-3-(1-tert-Butoxycarbonylamino-ethyl)-benzoic acid, 95%, (R)-3-(1-tert-Butoxycarbonylamino-ethyl)-benzoic acid ee, (R)-3-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%, 95%, (R)-3-(1-tert-Butoxycarbonylamino-ethyl)-benzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 193150-14-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: JWYITCUSPYOBSX-SECBINFHSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
| InChIKey | JWYITCUSPYOBSX-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)