CAS 166337-57-1 appears in our catalog under these names: 5-Methyl-3-pyridinesulfonyl chloride, 97%, 97%, 5-Methyl-pyridine-3-sulfonyl chloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methylpyridine-3-sulfonyl chloride (CAS 166337-57-1) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 5-methylpyridine-3-sulfonyl chloride. InChIKey: MSJZQOHFAWAQMR-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 5-methylpyridine-3-sulfonyl chloride |
| InChIKey | MSJZQOHFAWAQMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)