Products 1664384-14-8
CAS 1664384-14-8 is the registry number for 4'-(2-Bromophenyl)-2,2':6',2''-terpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(2-bromophenyl)-2,6-dipyridin-2-ylpyridine (CAS 1664384-14-8) is a chemical compound with the molecular formula C21H14BrN3 and a molecular weight of 388.3 g/mol. IUPAC name: 4-(2-bromophenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: HWVNBXHCEGIZRA-UHFFFAOYSA-N.
| Molecular formula | C21H14BrN3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 4-(2-bromophenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | HWVNBXHCEGIZRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4)Br |
Computed by PubChem (NCBI)