CAS 420791-74-8 is the registry number for 4'-(4-Bromophenyl)-4,2':6',4''-terpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-bromophenyl)-2,6-dipyridin-4-ylpyridine (CAS 420791-74-8) is a chemical compound with the molecular formula C21H14BrN3 and a molecular weight of 388.3 g/mol. IUPAC name: 4-(4-bromophenyl)-2,6-dipyridin-4-ylpyridine. InChIKey: XOPURPJMNMAYKB-UHFFFAOYSA-N.
| Molecular formula | C21H14BrN3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2,6-dipyridin-4-ylpyridine |
| InChIKey | XOPURPJMNMAYKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=C2)C3=CC=NC=C3)C4=CC=NC=C4)Br |
Computed by PubChem (NCBI)