Products 77989-15-2
CAS 77989-15-2 appears in our catalog under these names: 2-(2-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, 98%, 2-(2-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, 99%, 99%, 2-(2-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, >98.0%(HPLC)(N). Offered by: Fluorochem, Chemat, TCI. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 200mg.
2-(2-bromophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 77989-15-2) is a chemical compound with the molecular formula C21H14BrN3 and a molecular weight of 388.3 g/mol. IUPAC name: 2-(2-bromophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: MSTJGWCHJCZPEQ-UHFFFAOYSA-N.
| Molecular formula | C21H14BrN3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | MSTJGWCHJCZPEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)