CAS 864377-31-1 appears in our catalog under these names: 2-(3-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, >97.0%(HPLC)(N), 2-(3-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, 97%, 97%, 2-(3-Bromophenyl)-4,6-diphenyl-1,3,5-triazine, 97%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 50g, 250g, 10g, 25g, 100g.
2-(3-bromophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 864377-31-1) is a chemical compound with the molecular formula C21H14BrN3 and a molecular weight of 388.3 g/mol. IUPAC name: 2-(3-bromophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: HNZUKQQNZRMNGS-UHFFFAOYSA-N.
| Molecular formula | C21H14BrN3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | HNZUKQQNZRMNGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=CC=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)