CAS 89972-76-9 appears in our catalog under these names: 4'–(4–Bromophenyl)–2,6':2',2''–terpyridine, 4'-(4-Bromophenyl)-2,2':6',2''-terpyridine, 97% , 4'-(4-Bromophenyl)-2,2':6',2''-terpyridine, >97.0%(HPLC)(T), 4'-(4-BROMOPHENYL)-2,2':6',2''-TERPYRIDINE, 97%, 97%, 4'-(4-Bromophenyl)-2,2':6',2''-terpyridine, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg.
4-(4-bromophenyl)-2,6-dipyridin-2-ylpyridine (CAS 89972-76-9) is a chemical compound with the molecular formula C21H14BrN3 and a molecular weight of 388.3 g/mol. IUPAC name: 4-(4-bromophenyl)-2,6-dipyridin-2-ylpyridine. InChIKey: BOPPHKMZOYPASP-UHFFFAOYSA-N.
| Molecular formula | C21H14BrN3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2,6-dipyridin-2-ylpyridine |
| InChIKey | BOPPHKMZOYPASP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)