Products 16644-05-6
CAS 16644-05-6 appears in our catalog under these names: Dimethyl 2，2–dipropylmalonate, Dimethyl 2，2-dipropylmalonate, DIMETHYL 2,2-DIPROPYLMALONATE, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Dimethyl 2,2-dipropylpropanedioate (CAS 16644-05-6) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: dimethyl 2,2-dipropylpropanedioate. InChIKey: ZFMAHACGDXIMSE-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | dimethyl 2,2-dipropylpropanedioate |
| InChIKey | ZFMAHACGDXIMSE-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2,2-dipropylmalonate, dimethyl 2,2-dipropylpropanedioate, Propanedioic acid, dipropyl-, dimethyl ester, Propanedioic acid, 2,2-dipropyl-, 1,3-dimethyl ester, Malonic acid, dipropyl-, dimethyl ester, Dimethyl 22-dipropylmalonate, Dimethyl dipropylpropanedioate, Dimethyl2,2-dipropylmalonate, Dimethyl 2,2-dipropylmalonate #, ZFMAHACGDXIMSE-UHFFFAOYSA-N