Products 166525-46-8
CAS 166525-46-8 is the registry number for 2,6-Dichloro-α-ethyl-3-pyridinemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-dichloro-3-pyridinyl)propan-1-ol (CAS 166525-46-8) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 1-(2,6-dichloro-3-pyridinyl)propan-1-ol. InChIKey: QDOAIURMYKINHK-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-pyridinyl)propan-1-ol |
| InChIKey | QDOAIURMYKINHK-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(N=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)