Products 166586-72-7
CAS 166586-72-7 is the registry number for 1–(((Benzyloxy)carbonyl)amino)–2,3–dihydro–1H–indene–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
1-(phenylmethoxycarbonylamino)-2,3-dihydroindene-1-carboxylic acid (CAS 166586-72-7) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 1-(phenylmethoxycarbonylamino)-2,3-dihydroindene-1-carboxylic acid. InChIKey: CNCRHOHZCWWEEV-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 1-(phenylmethoxycarbonylamino)-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | CNCRHOHZCWWEEV-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)