CAS 166878-52-0 is the registry number for rac-(1R,2R,6S,7S)-10-(Propan-2-ylidene)-4-azatricyclo(5.2.1.0,2,6)decane-3,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,2R,6S,7S)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (CAS 166878-52-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (1R,2R,6S,7S)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione. InChIKey: MOTBPVCOQQBGNY-SWOGREBESA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (1R,2R,6S,7S)-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| InChIKey | MOTBPVCOQQBGNY-SWOGREBESA-N |
| SMILES | CC(=C1[C@@H]2CC[C@H]1[C@H]3[C@@H]2C(=O)NC3=O)C |
Computed by PubChem (NCBI)