Products 16691-78-4
CAS 16691-78-4 is the registry number for 4-Hydroxy-2,5-bis(methoxycarbonyl)-3,4-diphenyl-2-cyclopentenone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl 5-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1,3-dicarboxylate (CAS 16691-78-4) is a chemical compound with the molecular formula C21H18O6 and a molecular weight of 366.4 g/mol. IUPAC name: dimethyl 5-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1,3-dicarboxylate. InChIKey: STFCHYLBLBTJMZ-UHFFFAOYSA-N.
| Molecular formula | C21H18O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | dimethyl 5-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1,3-dicarboxylate |
| InChIKey | STFCHYLBLBTJMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(=O)C(=C(C1(C2=CC=CC=C2)O)C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)