CAS 166978-61-6 is the registry number for Methyl 1,1-dimethyl-3-oxo-2,3-dihydro-1H-indene-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1,1-dimethyl-3-oxo-2H-indene-5-carboxylate (CAS 166978-61-6) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: methyl 1,1-dimethyl-3-oxo-2H-indene-5-carboxylate. InChIKey: RZILJCXXPILJLF-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | methyl 1,1-dimethyl-3-oxo-2H-indene-5-carboxylate |
| InChIKey | RZILJCXXPILJLF-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C=CC(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)