CAS 1670-86-6 appears in our catalog under these names: 1H-Indole-4-carboxamide, 95%, 1H-Indole-4-carboxamide, 1H-Indole-4-carboxamide, 97%, 97%, 1H-Indole-4-carboxamide, min. 95 %, 10 mg, 1H-Indole-4-carboxamide, min. 95 %, 25 mg. Offered by: Combi-blocks, Biosynth, Chemat, Roth. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 50mg, 5g, 10g.
1H-indole-4-carboxamide (CAS 1670-86-6) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 1H-indole-4-carboxamide. InChIKey: ACRGIRLCXXEJCS-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 1H-indole-4-carboxamide |
| InChIKey | ACRGIRLCXXEJCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CNC2=C1)C(=O)N |
Computed by PubChem (NCBI)