CAS 1670-88-8 appears in our catalog under these names: 1H-Indole-6-carboxamide, 95%, 1H-Indole-6-carboxamide, 1H-Indole-6-carboxamide 98%, 1H-Indole-6-carboxamide, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 25g.
1H-indole-6-carboxamide (CAS 1670-88-8) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 1H-indole-6-carboxamide. InChIKey: KJLFFCRGGGXQKE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 1H-indole-6-carboxamide |
| InChIKey | KJLFFCRGGGXQKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)C(=O)N |
Computed by PubChem (NCBI)