Products 167011-44-1
CAS 167011-44-1 is the registry number for 5,6-Dihydro-2H-thiopyran-3-carboxylic acid 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylic acid (CAS 167011-44-1) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: 1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylic acid. InChIKey: DIGHCXJBHXMYOW-UHFFFAOYSA-N.
| Molecular formula | C6H8O4S |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | 1,1-dioxo-3,6-dihydro-2H-thiopyran-5-carboxylic acid |
| InChIKey | DIGHCXJBHXMYOW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC(=C1)C(=O)O |
Computed by PubChem (NCBI)