CAS 2750509-72-7 appears in our catalog under these names: Rel-(1R,5S,6s)-3-thiabicyclo[3.1.0]hexane-6-carboxylic acid 3,3-dioxide, 98%, (1R,5S,6R)-3,3-dioxo-3lambda6-thiabicyclo[3.1.0]hexane-6-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(1R,5S)-3,3-dioxo-3lambda6-thiabicyclo[3.1.0]hexane-6-carboxylic acid (CAS 2750509-72-7) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: (1R,5S)-3,3-dioxo-3lambda6-thiabicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: IUZPVUZQTFUBDQ-NGQZWQHPSA-N.
| Molecular formula | C6H8O4S |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | (1R,5S)-3,3-dioxo-3lambda6-thiabicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | IUZPVUZQTFUBDQ-NGQZWQHPSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(=O)O)CS1(=O)=O |
Computed by PubChem (NCBI)