Products 99418-17-4

CAS 99418-17-4 appears in our catalog under these names: 2-Methyl-4,5-dihydrothiophene-3-carboxylic acid 1,1-dioxide, 95%, 2-Methyl-1,1-dioxo-4,5-dihydro-1λâ¶-thiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

5-methyl-1,1-dioxo-2,3-dihydrothiophene-4-carboxylic acid (CAS 99418-17-4) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: 5-methyl-1,1-dioxo-2,3-dihydrothiophene-4-carboxylic acid. InChIKey: XAXGGGGBOQHBOV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8O4S
Molecular weight176.19 g/mol
IUPAC name5-methyl-1,1-dioxo-2,3-dihydrothiophene-4-carboxylic acid
InChIKeyXAXGGGGBOQHBOV-UHFFFAOYSA-N
SMILESCC1=C(CCS1(=O)=O)C(=O)O

Computed by PubChem (NCBI)