CAS 99418-18-5 appears in our catalog under these names: 3,4-Dihydro-2H-thiopyran-5-carboxylic acid 1,1-dioxide, 95%, 3,​4-​Dihydro-2H-thiopyran-​5-​carboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
1,1-dioxo-3,4-dihydro-2H-thiopyran-5-carboxylic acid (CAS 99418-18-5) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-thiopyran-5-carboxylic acid. InChIKey: QXWCCUNTWLGBAB-UHFFFAOYSA-N.
| Molecular formula | C6H8O4S |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-thiopyran-5-carboxylic acid |
| InChIKey | QXWCCUNTWLGBAB-UHFFFAOYSA-N |
| SMILES | C1CC(=CS(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)