CAS 16706-54-0 appears in our catalog under these names: N-Cbz-guanidine, 97%, N-CBz-guanidine, Phenylmethyl N-(aminoiminomethyl)carbamate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
Benzyl N-(diaminomethylidene)carbamate (CAS 16706-54-0) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: benzyl N-(diaminomethylidene)carbamate. InChIKey: FZOCFRPFPKJHHP-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | benzyl N-(diaminomethylidene)carbamate |
| InChIKey | FZOCFRPFPKJHHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N=C(N)N |
Computed by PubChem (NCBI)