CAS 1671-18-7 is the registry number for 2-Chloro-1-methyl-(4-methylsulfonyl) benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 10g, 1g.
2-chloro-1-methyl-4-methylsulfonylbenzene (CAS 1671-18-7) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 2-chloro-1-methyl-4-methylsulfonylbenzene. InChIKey: YHIYSPGAOWANSA-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 2-chloro-1-methyl-4-methylsulfonylbenzene |
| InChIKey | YHIYSPGAOWANSA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C)Cl |
Computed by PubChem (NCBI)