Products 609-60-9
CAS 609-60-9 appears in our catalog under these names: 2,4-DIMETHYLBENZENESULFONYL CHLORIDE, 9&, 2,4-Dimethylbenzenesulfonyl chloride, 95%, 2,4-Dimethylbenzene-1-sulfonyl chloride, 95%, Vortioxetine Impurity 67, 2,4-Dimethylbenzenesulfonyl Chloride. Offered by: Sigma-Aldrich, Combi-blocks, Chemat Brand, TRC, Thermo Scientific (Alfa Aesar). Available pack sizes: 1G, 25g, 5g, on request, 250mg, 10g.
2,4-dimethylbenzenesulfonyl chloride (CAS 609-60-9) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 2,4-dimethylbenzenesulfonyl chloride. InChIKey: FREOGXBZEAMJQN-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 2,4-dimethylbenzenesulfonyl chloride |
| InChIKey | FREOGXBZEAMJQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
2,4-dimethylbenzenesulfonyl chloride, 2,4-dimethylbenzene-1-sulfonyl chloride, Benzenesulfonyl chloride, 2,4-dimethyl-, 2,4-Dimethylbenzene sulfonyl chloride, 2,4-Dimethyl-benzenesulfonyl chloride, (2,4-dimethylphenyl)chlorosulfone, 2,4-Dimethyl benzene sulfonyl chloride, 1-(2,4-dimethylphenyl)sulfonyl chloride, 2,4-Dimethylbenzenesulfonyl chloride, 97%