CAS 2905-30-8 appears in our catalog under these names: 3,4-Dimethylbenzenesulfonyl chloride, 95%, 3,4-Dimethylbenzenesulfonyl chloride, 98%, 3,4-Dimethylbenzenesulfonyl chloride, 98% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
3,4-dimethylbenzenesulfonyl chloride (CAS 2905-30-8) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 3,4-dimethylbenzenesulfonyl chloride. InChIKey: DNMQPRPJIWTNAX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 3,4-dimethylbenzenesulfonyl chloride |
| InChIKey | DNMQPRPJIWTNAX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)