CAS 16727-43-8 appears in our catalog under these names: 2,6–Dimethoxypyridine–3–carboxylic acid, 2,6-Dimethoxynicotinic acid 95%, 2,6-Dimethoxypyridine-3-carboxylic acid, 98%, 98%, 2,6-Dimethoxynicotinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
2,6-dimethoxypyridine-3-carboxylic acid (CAS 16727-43-8) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2,6-dimethoxypyridine-3-carboxylic acid. InChIKey: SDJQZCSCHUIITF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 2,6-dimethoxypyridine-3-carboxylic acid |
| InChIKey | SDJQZCSCHUIITF-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)