Products 16730-20-4
CAS 16730-20-4 appears in our catalog under these names: 5–Nitro–1H–indole–2–carboxylic acid, 5-Nitro-1H-indole-2-carboxylic Acid, >97.0%(GC)(T), 5-Nitro-1H-indole-2-carboxylic acid, 97%, 97%, 5-Nitroindole-2-carboxylic acid, 90%, 5-Nitro-1H-indole-2-carboxylic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g.
5-nitro-1H-indole-2-carboxylic acid (CAS 16730-20-4) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 5-nitro-1H-indole-2-carboxylic acid. InChIKey: LHFOJSCXLFKDIR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 5-nitro-1H-indole-2-carboxylic acid |
| InChIKey | LHFOJSCXLFKDIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=C(N2)C(=O)O |
Computed by PubChem (NCBI)