CAS 167405-28-9 is the registry number for 1-(2-Amino-4-(trifluoromethyl)thiazol-5-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
1-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (CAS 167405-28-9) is a chemical compound with the molecular formula C6H5F3N2OS and a molecular weight of 210.18 g/mol. IUPAC name: 1-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone. InChIKey: WATJHCODYKTHLP-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2OS |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1-[2-amino-4-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| InChIKey | WATJHCODYKTHLP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(S1)N)C(F)(F)F |
Computed by PubChem (NCBI)