CAS 339026-31-2 is the registry number for 2-Methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (CAS 339026-31-2) is a chemical compound with the molecular formula C6H5F3N2OS and a molecular weight of 210.18 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide. InChIKey: HTIHRJDIZSTSGF-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2OS |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| InChIKey | HTIHRJDIZSTSGF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)