CAS 2060523-52-4 is the registry number for (Z)-N'-Hydroxy-2-(trifluoromethyl)thiophene-3-carboximidamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N'-hydroxy-2-(trifluoromethyl)thiophene-3-carboximidamide (CAS 2060523-52-4) is a chemical compound with the molecular formula C6H5F3N2OS and a molecular weight of 210.18 g/mol. IUPAC name: N'-hydroxy-2-(trifluoromethyl)thiophene-3-carboximidamide. InChIKey: WLRPHGBVBBKAHI-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2OS |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | N'-hydroxy-2-(trifluoromethyl)thiophene-3-carboximidamide |
| InChIKey | WLRPHGBVBBKAHI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1/C(=N/O)/N)C(F)(F)F |
Computed by PubChem (NCBI)