CAS 1695546-50-9 appears in our catalog under these names: 1-(2-Amino-4-methyl-1,3-thiazol-5-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(2-Amino-4-methyl-1,3-thiazol-5-yl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,2,2-trifluoroethanone (CAS 1695546-50-9) is a chemical compound with the molecular formula C6H5F3N2OS and a molecular weight of 210.18 g/mol. IUPAC name: 1-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,2,2-trifluoroethanone. InChIKey: BAAXCOUYFDTBRJ-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2OS |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 1-(2-amino-4-methyl-1,3-thiazol-5-yl)-2,2,2-trifluoroethanone |
| InChIKey | BAAXCOUYFDTBRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)