Products 88434-69-9
CAS 88434-69-9 appears in our catalog under these names: Nifedipine Impurity 6, Nifedipine Impurity 3, Nifedipine Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1-oxidopyridin-1-ium-3,5-dicarboxylate (CAS 88434-69-9) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1-oxidopyridin-1-ium-3,5-dicarboxylate. InChIKey: IZGBDGFUKMYXTQ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1-oxidopyridin-1-ium-3,5-dicarboxylate |
| InChIKey | IZGBDGFUKMYXTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=[N+]1[O-])C)C(=O)OC)C2=CC=CC=C2[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)