CAS 2559404-67-8 is the registry number for CDA-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (CAS 2559404-67-8) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid. InChIKey: AXHKKSCIPXKGHG-XFFZJAGNSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| InChIKey | AXHKKSCIPXKGHG-XFFZJAGNSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C\2/C(=O)NC(=O)N(C2=O)CC=C)OCC(=O)O |
Computed by PubChem (NCBI)