CAS 16761-18-5 appears in our catalog under these names: 4-Acetamido-3-chlorobenzenesulfonyl chloride, 95%, 3-chloro-4-acetamidobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
4-acetamido-3-chlorobenzenesulfonyl chloride (CAS 16761-18-5) is a chemical compound with the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. IUPAC name: 4-acetamido-3-chlorobenzenesulfonyl chloride. InChIKey: ALOQYFFSHSEVJH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3S |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | 4-acetamido-3-chlorobenzenesulfonyl chloride |
| InChIKey | ALOQYFFSHSEVJH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)