Products 1954-95-6

CAS 1954-95-6 appears in our catalog under these names: 4-Acetamido-2-chlorobenzene-1-sulfonyl chloride, 97%, 4-Acetamido-2-chlorobenzenesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

4-acetamido-2-chlorobenzenesulfonyl chloride (CAS 1954-95-6) is a chemical compound with the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. IUPAC name: 4-acetamido-2-chlorobenzenesulfonyl chloride. InChIKey: MSSDFXARSXTRSY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Cl2NO3S
Molecular weight268.12 g/mol
IUPAC name4-acetamido-2-chlorobenzenesulfonyl chloride
InChIKeyMSSDFXARSXTRSY-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=C(C=C1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)