CAS 632356-39-9 appears in our catalog under these names: Methyl 3-acetamido-4,5-dichlorothiophene-2-carboxylate, 95%, 3-AcetylaMino-4,5-dichlorothiphene-2-carboxylic acid Methyl ester, 95%, 3–acetylaMino–4,5–dichlorothiphene–2–carboxylic acid Methyl ester. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-acetamido-4,5-dichlorothiophene-2-carboxylate (CAS 632356-39-9) is a chemical compound with the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. IUPAC name: methyl 3-acetamido-4,5-dichlorothiophene-2-carboxylate. InChIKey: ACBQXSGPYIMTDS-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3S |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | methyl 3-acetamido-4,5-dichlorothiophene-2-carboxylate |
| InChIKey | ACBQXSGPYIMTDS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(SC(=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)