CAS 62971-62-4 appears in our catalog under these names: 5-Acetyl-2,4-dichlorobenzene-1-sulfonamide, 95%, 5-Acetyl-2,4-dichlorobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-acetyl-2,4-dichlorobenzenesulfonamide (CAS 62971-62-4) is a chemical compound with the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. IUPAC name: 5-acetyl-2,4-dichlorobenzenesulfonamide. InChIKey: SACDLDIMGQGNIK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3S |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | 5-acetyl-2,4-dichlorobenzenesulfonamide |
| InChIKey | SACDLDIMGQGNIK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)