Products 167684-45-9
CAS 167684-45-9 is the registry number for (3aR,5R,7aS)-1,3-Dioxooctahydroisobenzofuran-5-carboxylic Acid, >95.0%(T)(qNMR). Offered by: TCI. Available pack sizes: 5g, 25g.
(3aR,5R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid (CAS 167684-45-9) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: (3aR,5R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid. InChIKey: FWHUTKPMCKSUCV-NGJCXOISSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | (3aR,5R,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid |
| InChIKey | FWHUTKPMCKSUCV-NGJCXOISSA-N |
| SMILES | C1C[C@H]2[C@@H](C[C@@H]1C(=O)O)C(=O)OC2=O |
Computed by PubChem (NCBI)