Products 19861-64-4
CAS 19861-64-4 appears in our catalog under these names: 2,4-Dichloro-5-cyanobenzoic acid 95%, 2,4-Dichloro-5-cyanobenzoic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
2,4-dichloro-5-cyanobenzoic acid (CAS 19861-64-4) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 2,4-dichloro-5-cyanobenzoic acid. InChIKey: AYPJXGQEGIPRRG-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 2,4-dichloro-5-cyanobenzoic acid |
| InChIKey | AYPJXGQEGIPRRG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)Cl)Cl)C#N |
Computed by PubChem (NCBI)