Products 16795-96-3
CAS 16795-96-3 is the registry number for Renierol. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(hydroxymethyl)-7-methoxy-6-methylisoquinoline-5,8-dione (CAS 16795-96-3) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 1-(hydroxymethyl)-7-methoxy-6-methylisoquinoline-5,8-dione. InChIKey: RKJCLRAJHCIHAH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-(hydroxymethyl)-7-methoxy-6-methylisoquinoline-5,8-dione |
| InChIKey | RKJCLRAJHCIHAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)C=CN=C2CO)OC |
Computed by PubChem (NCBI)