Products 167993-12-6
CAS 167993-12-6 appears in our catalog under these names: 5-Amino-di-t-butyl isophathalate, 98%, Di-tert-butyl 5-aminoisophthalate, 95+%, Di–tert–butyl 5–aminoisophthalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ditert-butyl 5-aminobenzene-1,3-dicarboxylate (CAS 167993-12-6) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: ditert-butyl 5-aminobenzene-1,3-dicarboxylate. InChIKey: ZLLMUGBKHWIFJC-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | ditert-butyl 5-aminobenzene-1,3-dicarboxylate |
| InChIKey | ZLLMUGBKHWIFJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)