Products 168254-96-4
CAS 168254-96-4 is the registry number for Evofolin B. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
3-hydroxy-1,2-bis(4-hydroxy-3-methoxyphenyl)propan-1-one (CAS 168254-96-4) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: 3-hydroxy-1,2-bis(4-hydroxy-3-methoxyphenyl)propan-1-one. InChIKey: QMYGRGKKZBRZKH-UHFFFAOYSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | 3-hydroxy-1,2-bis(4-hydroxy-3-methoxyphenyl)propan-1-one |
| InChIKey | QMYGRGKKZBRZKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(CO)C(=O)C2=CC(=C(C=C2)O)OC)O |
Computed by PubChem (NCBI)