CAS 1684394-71-5 is the registry number for [1,1':3',1'':4'',1'''-Quaterphenyl]-4,4''',5'-tricarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-carboxyphenyl)-5-[4-(4-carboxyphenyl)phenyl]benzoic acid (CAS 1684394-71-5) is a chemical compound with the molecular formula C27H18O6 and a molecular weight of 438.4 g/mol. IUPAC name: 3-(4-carboxyphenyl)-5-[4-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: VVYIIALPRIDPAW-UHFFFAOYSA-N.
| Molecular formula | C27H18O6 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 3-(4-carboxyphenyl)-5-[4-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | VVYIIALPRIDPAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)