Products 2005517-60-0
CAS 2005517-60-0 appears in our catalog under these names: (1,1'：4',1''：4'',1'''–quaterphenyl)–3,4''',5–tricarboxylic acid, [1,1':4',1'':4'',1'''-Quaterphenyl]-3,4''',5-tricarboxylic acid, 97%, 97%, [1,1':4',1'':4'',1'''-quaterphenyl]-3,4''',5-tricarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzene-1,3-dicarboxylic acid (CAS 2005517-60-0) is a chemical compound with the molecular formula C27H18O6 and a molecular weight of 438.4 g/mol. IUPAC name: 5-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzene-1,3-dicarboxylic acid. InChIKey: MQRRKKMHEJISCG-UHFFFAOYSA-N.
| Molecular formula | C27H18O6 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 5-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | MQRRKKMHEJISCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)