Products 1259390-34-5
CAS 1259390-34-5 appears in our catalog under these names: 5'-(4-Carboxyphenyl)-[1,1':3',1''-terphenyl]-3,3''-dicarboxylic acid, 98%, 98%, 5'-(4-Carboxyphenyl)-[1,1':3',1''-terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[3-(3-carboxyphenyl)-5-(4-carboxyphenyl)phenyl]benzoic acid (CAS 1259390-34-5) is a chemical compound with the molecular formula C27H18O6 and a molecular weight of 438.4 g/mol. IUPAC name: 3-[3-(3-carboxyphenyl)-5-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: UXAYRVUKGQGCPF-UHFFFAOYSA-N.
| Molecular formula | C27H18O6 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 3-[3-(3-carboxyphenyl)-5-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | UXAYRVUKGQGCPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=CC(=CC=C4)C(=O)O |
Computed by PubChem (NCBI)