Products 2052184-35-5
CAS 2052184-35-5 is the registry number for 5'-(4-Formylphenyl)-2',4',6'-trihydroxy-[1,1':3',1''-terphenyl]-4,4''-dicarbaldehyde, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
4-[3,5-bis(4-formylphenyl)-2,4,6-trihydroxyphenyl]benzaldehyde (CAS 2052184-35-5) is a chemical compound with the molecular formula C27H18O6 and a molecular weight of 438.4 g/mol. IUPAC name: 4-[3,5-bis(4-formylphenyl)-2,4,6-trihydroxyphenyl]benzaldehyde. InChIKey: ZTMVUHLZQMAHDJ-UHFFFAOYSA-N.
| Molecular formula | C27H18O6 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 4-[3,5-bis(4-formylphenyl)-2,4,6-trihydroxyphenyl]benzaldehyde |
| InChIKey | ZTMVUHLZQMAHDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C(=C(C(=C2O)C3=CC=C(C=C3)C=O)O)C4=CC=C(C=C4)C=O)O |
Computed by PubChem (NCBI)